C9H17F3IN3O2S — CID 111778350
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 111778350) has the molecular formula C9H17F3IN3O2S and a molecular weight of 415.22 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111778350 |
| Molecular Formula | C9H17F3IN3O2S |
| Molecular Weight | 415.22 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C9H16F3N3O2S.HI/c1-13-8(14-4-3-9(10,11)12)15-7-2-5-18(16,17)6-7;/h7H,2-6H2,1H3,(H2,13,14,15);1H |
| InChIKey | UDYFZWUDAFPCAP-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|