C9H16F3N3O2S — CID 111778351
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 111778351) has the molecular formula C9H16F3N3O2S and a molecular weight of 287.31 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 111778351 |
| Molecular Formula | C9H16F3N3O2S |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCC(F)(F)F)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16F3N3O2S/c1-13-8(14-4-3-9(10,11)12)15-7-2-5-18(16,17)6-7/h7H,2-6H2,1H3,(H2,13,14,15) |
| InChIKey | LJKFFMIMJPWTEL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|