About 1-ethyl-2-propyl-3-(3,3,3-trifluoropropyl)guanidine
1-ethyl-2-propyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 111778479) has the molecular formula C9H18F3N3
and a molecular weight of 225.26 g/mol. Its IUPAC name is 1-ethyl-2-propyl-3-(3,3,3-trifluoropropyl)guanidine.
Molecular Properties
| Compound Name | 1-ethyl-2-propyl-3-(3,3,3-trifluoropropyl)guanidine |
| PubChem CID | 111778479 |
| Molecular Formula | C9H18F3N3 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 1-ethyl-2-propyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCC/N=C(\NCC)NCCC(F)(F)F |
| InChI | InChI=1S/C9H18F3N3/c1-3-6-14-8(13-4-2)15-7-5-9(10,11)12/h3-7H2,1-2H3,(H2,13,14,15) |
| InChIKey | CYDMJANATIDWFE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-propyl-3-(3,3,3-trifluoropropyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-propyl-3-(3,3,3-trifluoropropyl)guanidine?
The IUPAC name of 1-ethyl-2-propyl-3-(3,3,3-trifluoropropyl)guanidine (CID 111778479) is 1-ethyl-2-propyl-3-(3,3,3-trifluoropropyl)guanidine.
What is the SMILES notation for 1-ethyl-2-propyl-3-(3,3,3-trifluoropropyl)guanidine?
The canonical SMILES for 1-ethyl-2-propyl-3-(3,3,3-trifluoropropyl)guanidine is CCC/N=C(\NCC)NCCC(F)(F)F.
What is the InChIKey of 1-ethyl-2-propyl-3-(3,3,3-trifluoropropyl)guanidine?
The InChIKey is CYDMJANATIDWFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3N3/c1-3-6-14-8(13-4-2)15-7-5-9(10,11)12/h3-7H2,1-2H3,(H2,13,14,15).
What are the key properties of 1-ethyl-2-propyl-3-(3,3,3-trifluoropropyl)guanidine?
1-ethyl-2-propyl-3-(3,3,3-trifluoropropyl)guanidine has a molecular weight of 225.26 g/mol, XLogP of 1.90, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-propyl-3-(3,3,3-trifluoropropyl)guanidine is sourced from PubChem (CID 111778479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).