C27H31N3O2 — CID 11177885
1-methyl-3-[[6-[1-(3,5,5,8,8-pentamethylnaphthalen-2-yl)ethenyl]-3-pyridinyl]methyl]imidazolidine-2,4-dione (PubChem CID 11177885) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 1-methyl-3-[[6-[1-(3,5,5,8,8-pentamethylnaphthalen-2-yl)ethenyl]-3-pyridinyl]methyl]imidazolidine-2,4-dione.
| Compound Name | 1-methyl-3-[[6-[1-(3,5,5,8,8-pentamethylnaphthalen-2-yl)ethenyl]-3-pyridinyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11177885 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 1-methyl-3-[[6-[1-(3,5,5,8,8-pentamethylnaphthalen-2-yl)ethenyl]-3-pyridinyl]methyl]imidazolidine-2,4-dione |
| SMILES | C=C(c1ccc(CN2C(=O)CN(C)C2=O)cn1)c1cc2c(cc1C)C(C)(C)C=CC2(C)C |
| InChI | InChI=1S/C27H31N3O2/c1-17-12-21-22(27(5,6)11-10-26(21,3)4)13-20(17)18(2)23-9-8-19(14-28-23)15-30-24(31)16-29(7)25(30)32/h8-14H,2,15-16H2,1,3-7H3 |
| InChIKey | LZVKLUOBHWFMPG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|