C16H34N4O3 — CID 111779323
tert-butyl N-[3-[[N-(3-methoxypropyl)-N'-methylcarbamimidoyl]amino]-2-methylpropyl]-N-methylcarbamate (PubChem CID 111779323) has the molecular formula C16H34N4O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-(3-methoxypropyl)-N'-methylcarbamimidoyl]amino]-2-methylpropyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[[N-(3-methoxypropyl)-N'-methylcarbamimidoyl]amino]-2-methylpropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 111779323 |
| Molecular Formula | C16H34N4O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | tert-butyl N-[3-[[N-(3-methoxypropyl)-N'-methylcarbamimidoyl]amino]-2-methylpropyl]-N-methylcarbamate |
| SMILES | C/N=C(\NCCCOC)NCC(C)CN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H34N4O3/c1-13(12-20(6)15(21)23-16(2,3)4)11-19-14(17-5)18-9-8-10-22-7/h13H,8-12H2,1-7H3,(H2,17,18,19) |
| InChIKey | BGDZAWJHHLGIJE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|