C27H44O4 — CID 11177980
ethyl (2E,6E,10E)-3,11,15-trimethyl-7-(oxan-2-yloxymethyl)hexadeca-2,6,10,14-tetraenoate (PubChem CID 11177980) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is ethyl (2E,6E,10E)-3,11,15-trimethyl-7-(oxan-2-yloxymethyl)hexadeca-2,6,10,14-tetraenoate.
| Compound Name | ethyl (2E,6E,10E)-3,11,15-trimethyl-7-(oxan-2-yloxymethyl)hexadeca-2,6,10,14-tetraenoate |
|---|---|
| PubChem CID | 11177980 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | ethyl (2E,6E,10E)-3,11,15-trimethyl-7-(oxan-2-yloxymethyl)hexadeca-2,6,10,14-tetraenoate |
| SMILES | CCOC(=O)/C=C(\C)CC/C=C(\CC/C=C(\C)CCC=C(C)C)COC1CCCCO1 |
| InChI | InChI=1S/C27H44O4/c1-6-29-26(28)20-24(5)15-11-17-25(21-31-27-18-7-8-19-30-27)16-10-14-23(4)13-9-12-22(2)3/h12,14,17,20,27H,6-11,13,15-16,18-19,21H2,1-5H3/b23-14+,24-20+,25-17+ |
| InChIKey | LSTXUSREMIDLTB-YZZXHNABSA-N |
| XLogP | 7.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|