C14H17IO8 — CID 11178166
[(1S,4R,5S,6R)-4,5,6-triacetyloxy-3-iodocyclohex-2-en-1-yl] acetate (PubChem CID 11178166) has the molecular formula C14H17IO8 and a molecular weight of 440.19 g/mol. Its IUPAC name is [(1S,4R,5S,6R)-4,5,6-triacetyloxy-3-iodocyclohex-2-en-1-yl] acetate.
| Compound Name | [(1S,4R,5S,6R)-4,5,6-triacetyloxy-3-iodocyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 11178166 |
| Molecular Formula | C14H17IO8 |
| Molecular Weight | 440.19 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | [(1S,4R,5S,6R)-4,5,6-triacetyloxy-3-iodocyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)C(I)=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H17IO8/c1-6(16)20-11-5-10(15)12(21-7(2)17)14(23-9(4)19)13(11)22-8(3)18/h5,11-14H,1-4H3/t11-,12-,13+,14+/m0/s1 |
| InChIKey | DJUQISAVYXROEP-IGQOVBAYSA-N |
| XLogP | 1.05 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|