C16H24F3N3O2 — CID 111782682
1-(3-ethoxypropyl)-2-methyl-3-[2-[2-(trifluoromethyl)phenoxy]ethyl]guanidine (PubChem CID 111782682) has the molecular formula C16H24F3N3O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-2-methyl-3-[2-[2-(trifluoromethyl)phenoxy]ethyl]guanidine.
| Compound Name | 1-(3-ethoxypropyl)-2-methyl-3-[2-[2-(trifluoromethyl)phenoxy]ethyl]guanidine |
|---|---|
| PubChem CID | 111782682 |
| Molecular Formula | C16H24F3N3O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 1-(3-ethoxypropyl)-2-methyl-3-[2-[2-(trifluoromethyl)phenoxy]ethyl]guanidine |
| SMILES | CCOCCCN/C(=N\C)NCCOc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H24F3N3O2/c1-3-23-11-6-9-21-15(20-2)22-10-12-24-14-8-5-4-7-13(14)16(17,18)19/h4-5,7-8H,3,6,9-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | PGGJWANOJKDXSQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|