C16H31N5O — CID 111783225
1-[2-[di(propan-2-yl)amino]ethyl]-3-[(3-ethyl-1,2-oxazol-5-yl)methyl]-2-methylguanidine (PubChem CID 111783225) has the molecular formula C16H31N5O and a molecular weight of 309.46 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-3-[(3-ethyl-1,2-oxazol-5-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-[(3-ethyl-1,2-oxazol-5-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111783225 |
| Molecular Formula | C16H31N5O |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-[(3-ethyl-1,2-oxazol-5-yl)methyl]-2-methylguanidine |
| SMILES | CCc1cc(CN/C(=N/C)NCCN(C(C)C)C(C)C)on1 |
| InChI | InChI=1S/C16H31N5O/c1-7-14-10-15(22-20-14)11-19-16(17-6)18-8-9-21(12(2)3)13(4)5/h10,12-13H,7-9,11H2,1-6H3,(H2,17,18,19) |
| InChIKey | ZMHYPCPLNSWEIE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|