C18H26F3N3O2 — CID 111783681
1-ethyl-3-[2-(oxolan-2-ylmethoxy)ethyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111783681) has the molecular formula C18H26F3N3O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 1-ethyl-3-[2-(oxolan-2-ylmethoxy)ethyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(oxolan-2-ylmethoxy)ethyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111783681 |
| Molecular Formula | C18H26F3N3O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 1-ethyl-3-[2-(oxolan-2-ylmethoxy)ethyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCCOCC1CCCO1 |
| InChI | InChI=1S/C18H26F3N3O2/c1-2-22-17(23-8-10-25-13-16-7-4-9-26-16)24-12-14-5-3-6-15(11-14)18(19,20)21/h3,5-6,11,16H,2,4,7-10,12-13H2,1H3,(H2,22,23,24) |
| InChIKey | ORULNYPRIWEYET-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|