C20H32F3IN4O — CID 111783996
2-[[4-(dimethylamino)oxan-4-yl]methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 111783996) has the molecular formula C20H32F3IN4O and a molecular weight of 528.40 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)oxan-4-yl]methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[4-(dimethylamino)oxan-4-yl]methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111783996 |
| Molecular Formula | C20H32F3IN4O |
| Molecular Weight | 528.40 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 2-[[4-(dimethylamino)oxan-4-yl]methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(N(C)C)CCOCC1)NCCc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C20H31F3N4O.HI/c1-4-24-18(26-15-19(27(2)3)10-13-28-14-11-19)25-12-9-16-5-7-17(8-6-16)20(21,22)23;/h5-8H,4,9-15H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | YWNWFUJBDJITAB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|