About 2-[3-chloro-4-[2,2-dimethyl-3-[4-(trifluoromethoxy)phenoxy]propyl]sulfanylphenyl]acetic acid
2-[3-chloro-4-[2,2-dimethyl-3-[4-(trifluoromethoxy)phenoxy]propyl]sulfanylphenyl]acetic acid (PubChem CID 11178408) has the molecular formula C20H20ClF3O4S
and a molecular weight of 448.89 g/mol. Its IUPAC name is 2-[3-chloro-4-[2,2-dimethyl-3-[4-(trifluoromethoxy)phenoxy]propyl]sulfanylphenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-chloro-4-[2,2-dimethyl-3-[4-(trifluoromethoxy)phenoxy]propyl]sulfanylphenyl]acetic acid |
| PubChem CID | 11178408 |
| Molecular Formula | C20H20ClF3O4S |
| Molecular Weight | 448.89 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 2-[3-chloro-4-[2,2-dimethyl-3-[4-(trifluoromethoxy)phenoxy]propyl]sulfanylphenyl]acetic acid |
| SMILES | CC(C)(COc1ccc(OC(F)(F)F)cc1)CSc1ccc(CC(=O)O)cc1Cl |
| InChI | InChI=1S/C20H20ClF3O4S/c1-19(2,11-27-14-4-6-15(7-5-14)28-20(22,23)24)12-29-17-8-3-13(9-16(17)21)10-18(25)26/h3-9H,10-12H2,1-2H3,(H,25,26) |
| InChIKey | SMBXBJQRVGNVRA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.89 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-chloro-4-[2,2-dimethyl-3-[4-(trifluoromethoxy)phenoxy]propyl]sulfanylphenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-chloro-4-[2,2-dimethyl-3-[4-(trifluoromethoxy)phenoxy]propyl]sulfanylphenyl]acetic acid?
The IUPAC name of 2-[3-chloro-4-[2,2-dimethyl-3-[4-(trifluoromethoxy)phenoxy]propyl]sulfanylphenyl]acetic acid (CID 11178408) is 2-[3-chloro-4-[2,2-dimethyl-3-[4-(trifluoromethoxy)phenoxy]propyl]sulfanylphenyl]acetic acid.
What is the SMILES notation for 2-[3-chloro-4-[2,2-dimethyl-3-[4-(trifluoromethoxy)phenoxy]propyl]sulfanylphenyl]acetic acid?
The canonical SMILES for 2-[3-chloro-4-[2,2-dimethyl-3-[4-(trifluoromethoxy)phenoxy]propyl]sulfanylphenyl]acetic acid is CC(C)(COc1ccc(OC(F)(F)F)cc1)CSc1ccc(CC(=O)O)cc1Cl.
What is the InChIKey of 2-[3-chloro-4-[2,2-dimethyl-3-[4-(trifluoromethoxy)phenoxy]propyl]sulfanylphenyl]acetic acid?
The InChIKey is SMBXBJQRVGNVRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20ClF3O4S/c1-19(2,11-27-14-4-6-15(7-5-14)28-20(22,23)24)12-29-17-8-3-13(9-16(17)21)10-18(25)26/h3-9H,10-12H2,1-2H3,(H,25,26).
What are the key properties of 2-[3-chloro-4-[2,2-dimethyl-3-[4-(trifluoromethoxy)phenoxy]propyl]sulfanylphenyl]acetic acid?
2-[3-chloro-4-[2,2-dimethyl-3-[4-(trifluoromethoxy)phenoxy]propyl]sulfanylphenyl]acetic acid has a molecular weight of 448.89 g/mol, XLogP of 6.06, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-chloro-4-[2,2-dimethyl-3-[4-(trifluoromethoxy)phenoxy]propyl]sulfanylphenyl]acetic acid is sourced from PubChem (CID 11178408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).