About 1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-(4-ethoxypiperidin-1-yl)phenyl]piperazine
1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-(4-ethoxypiperidin-1-yl)phenyl]piperazine (PubChem CID 11178556) has the molecular formula C29H49N3O
and a molecular weight of 455.73 g/mol. Its IUPAC name is 1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-(4-ethoxypiperidin-1-yl)phenyl]piperazine.
Molecular Properties
| Compound Name | 1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-(4-ethoxypiperidin-1-yl)phenyl]piperazine |
| PubChem CID | 11178556 |
| Molecular Formula | C29H49N3O |
| Molecular Weight | 455.73 g/mol |
| Exact Mass | 455.39 |
| IUPAC Name | 1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-(4-ethoxypiperidin-1-yl)phenyl]piperazine |
| SMILES | CCCCN1CCN(c2ccc(N3CCC(OCC)CC3)cc2C2CCC(C)(C)CC2)CC1 |
| InChI | InChI=1S/C29H49N3O/c1-5-7-16-30-19-21-32(22-20-30)28-9-8-25(31-17-12-26(13-18-31)33-6-2)23-27(28)24-10-14-29(3,4)15-11-24/h8-9,23-24,26H,5-7,10-22H2,1-4H3 |
| InChIKey | XLBFXIPYDZGXIQ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.73 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-(4-ethoxypiperidin-1-yl)phenyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-(4-ethoxypiperidin-1-yl)phenyl]piperazine?
The IUPAC name of 1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-(4-ethoxypiperidin-1-yl)phenyl]piperazine (CID 11178556) is 1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-(4-ethoxypiperidin-1-yl)phenyl]piperazine.
What is the SMILES notation for 1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-(4-ethoxypiperidin-1-yl)phenyl]piperazine?
The canonical SMILES for 1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-(4-ethoxypiperidin-1-yl)phenyl]piperazine is CCCCN1CCN(c2ccc(N3CCC(OCC)CC3)cc2C2CCC(C)(C)CC2)CC1.
What is the InChIKey of 1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-(4-ethoxypiperidin-1-yl)phenyl]piperazine?
The InChIKey is XLBFXIPYDZGXIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H49N3O/c1-5-7-16-30-19-21-32(22-20-30)28-9-8-25(31-17-12-26(13-18-31)33-6-2)23-27(28)24-10-14-29(3,4)15-11-24/h8-9,23-24,26H,5-7,10-22H2,1-4H3.
What are the key properties of 1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-(4-ethoxypiperidin-1-yl)phenyl]piperazine?
1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-(4-ethoxypiperidin-1-yl)phenyl]piperazine has a molecular weight of 455.73 g/mol, XLogP of 6.30, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-[2-(4,4-dimethylcyclohexyl)-4-(4-ethoxypiperidin-1-yl)phenyl]piperazine is sourced from PubChem (CID 11178556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).