C19H25ClIN3O2 — CID 111785828
1-[2-(3-chlorophenyl)ethyl]-3-[2-(2-hydroxy-4-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111785828) has the molecular formula C19H25ClIN3O2 and a molecular weight of 489.79 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-[2-(2-hydroxy-4-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-[2-(2-hydroxy-4-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111785828 |
| Molecular Formula | C19H25ClIN3O2 |
| Molecular Weight | 489.79 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-[2-(2-hydroxy-4-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1cccc(Cl)c1)NCCc1ccc(OC)cc1O.I |
| InChI | InChI=1S/C19H24ClN3O2.HI/c1-21-19(22-10-8-14-4-3-5-16(20)12-14)23-11-9-15-6-7-17(25-2)13-18(15)24;/h3-7,12-13,24H,8-11H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | APGAKPXNYSODGP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.79 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|