C26H36IN5O — CID 111786304
1-ethyl-3-[2-(7-methyl-1H-indol-3-yl)ethyl]-2-[[2-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111786304) has the molecular formula C26H36IN5O and a molecular weight of 561.51 g/mol. Its IUPAC name is 1-ethyl-3-[2-(7-methyl-1H-indol-3-yl)ethyl]-2-[[2-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(7-methyl-1H-indol-3-yl)ethyl]-2-[[2-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111786304 |
| Molecular Formula | C26H36IN5O |
| Molecular Weight | 561.51 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 1-ethyl-3-[2-(7-methyl-1H-indol-3-yl)ethyl]-2-[[2-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1CN1CCOCC1)NCCc1c[nH]c2c(C)cccc12.I |
| InChI | InChI=1S/C26H35N5O.HI/c1-3-27-26(28-12-11-22-18-29-25-20(2)7-6-10-24(22)25)30-17-21-8-4-5-9-23(21)19-31-13-15-32-16-14-31;/h4-10,18,29H,3,11-17,19H2,1-2H3,(H2,27,28,30);1H |
| InChIKey | PBCYGCSPWGYZLQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|