C18H21F3IN3 — CID 111786978
1-[2-(2,4-difluorophenyl)ethyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111786978) has the molecular formula C18H21F3IN3 and a molecular weight of 463.29 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenyl)ethyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,4-difluorophenyl)ethyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111786978 |
| Molecular Formula | C18H21F3IN3 |
| Molecular Weight | 463.29 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 1-[2-(2,4-difluorophenyl)ethyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1cccc(F)c1)NCCc1ccc(F)cc1F.I |
| InChI | InChI=1S/C18H20F3N3.HI/c1-22-18(23-9-7-13-3-2-4-15(19)11-13)24-10-8-14-5-6-16(20)12-17(14)21;/h2-6,11-12H,7-10H2,1H3,(H2,22,23,24);1H |
| InChIKey | TWCIPCBWTGMHKG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|