C19H40N4O — CID 111787119
1-ethyl-3-[2-(1-ethylpiperidin-4-yl)ethyl]-2-[3-(2-methylpropoxy)propyl]guanidine (PubChem CID 111787119) has the molecular formula C19H40N4O and a molecular weight of 340.56 g/mol. Its IUPAC name is 1-ethyl-3-[2-(1-ethylpiperidin-4-yl)ethyl]-2-[3-(2-methylpropoxy)propyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(1-ethylpiperidin-4-yl)ethyl]-2-[3-(2-methylpropoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111787119 |
| Molecular Formula | C19H40N4O |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.32 |
| IUPAC Name | 1-ethyl-3-[2-(1-ethylpiperidin-4-yl)ethyl]-2-[3-(2-methylpropoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CCCOCC(C)C)NCCC1CCN(CC)CC1 |
| InChI | InChI=1S/C19H40N4O/c1-5-20-19(21-11-7-15-24-16-17(3)4)22-12-8-18-9-13-23(6-2)14-10-18/h17-18H,5-16H2,1-4H3,(H2,20,21,22) |
| InChIKey | YLGVRSZUCMDVLK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|