C26H38O7 — CID 11178723
[(1R,3R,6S,8S,10R,11R,12S,15S)-8,10-diacetyloxy-11-hydroxy-6,12,16-trimethyl-2-methylidene-3-tricyclo[7.5.2.012,15]hexadec-9(16)-enyl] acetate (PubChem CID 11178723) has the molecular formula C26H38O7 and a molecular weight of 462.58 g/mol. Its IUPAC name is [(1R,3R,6S,8S,10R,11R,12S,15S)-8,10-diacetyloxy-11-hydroxy-6,12,16-trimethyl-2-methylidene-3-tricyclo[7.5.2.012,15]hexadec-9(16)-enyl] acetate.
| Compound Name | [(1R,3R,6S,8S,10R,11R,12S,15S)-8,10-diacetyloxy-11-hydroxy-6,12,16-trimethyl-2-methylidene-3-tricyclo[7.5.2.012,15]hexadec-9(16)-enyl] acetate |
|---|---|
| PubChem CID | 11178723 |
| Molecular Formula | C26H38O7 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | [(1R,3R,6S,8S,10R,11R,12S,15S)-8,10-diacetyloxy-11-hydroxy-6,12,16-trimethyl-2-methylidene-3-tricyclo[7.5.2.012,15]hexadec-9(16)-enyl] acetate |
| SMILES | C=C1[C@H](OC(C)=O)CC[C@H](C)C[C@H](OC(C)=O)C2=C(C)[C@@H]3[C@H]1CC[C@]3(C)[C@@H](O)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C26H38O7/c1-13-8-9-20(31-16(4)27)14(2)19-10-11-26(7)23(19)15(3)22(21(12-13)32-17(5)28)24(25(26)30)33-18(6)29/h13,19-21,23-25,30H,2,8-12H2,1,3-7H3/t13-,19-,20+,21-,23+,24+,25-,26-/m0/s1 |
| InChIKey | BEUNFZMOHHYNPI-QHCGCOPUSA-N |
| XLogP | 3.88 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|