C22H16F3NO3S2 — CID 11178744
4-phenyl-7-[[5-[(2S)-1,1,1-trifluoro-2-hydroxybutan-2-yl]-1,3-thiazol-2-yl]sulfanyl]chromen-2-one (PubChem CID 11178744) has the molecular formula C22H16F3NO3S2 and a molecular weight of 463.50 g/mol. Its IUPAC name is 4-phenyl-7-[[5-[(2S)-1,1,1-trifluoro-2-hydroxybutan-2-yl]-1,3-thiazol-2-yl]sulfanyl]chromen-2-one.
| Compound Name | 4-phenyl-7-[[5-[(2S)-1,1,1-trifluoro-2-hydroxybutan-2-yl]-1,3-thiazol-2-yl]sulfanyl]chromen-2-one |
|---|---|
| PubChem CID | 11178744 |
| Molecular Formula | C22H16F3NO3S2 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 4-phenyl-7-[[5-[(2S)-1,1,1-trifluoro-2-hydroxybutan-2-yl]-1,3-thiazol-2-yl]sulfanyl]chromen-2-one |
| SMILES | CC[C@@](O)(c1cnc(Sc2ccc3c(-c4ccccc4)cc(=O)oc3c2)s1)C(F)(F)F |
| InChI | InChI=1S/C22H16F3NO3S2/c1-2-21(28,22(23,24)25)18-12-26-20(31-18)30-14-8-9-15-16(13-6-4-3-5-7-13)11-19(27)29-17(15)10-14/h3-12,28H,2H2,1H3/t21-/m1/s1 |
| InChIKey | KODJGDQABHDJFP-OAQYLSRUSA-N |
| XLogP | 6.23 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|