C24H41N5O2 — CID 111789406
1-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine (PubChem CID 111789406) has the molecular formula C24H41N5O2 and a molecular weight of 431.63 g/mol. Its IUPAC name is 1-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine.
| Compound Name | 1-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111789406 |
| Molecular Formula | C24H41N5O2 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.33 |
| IUPAC Name | 1-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCC1CCN(CCOC)CC1)NCC(c1ccc(OC)cc1)N1CCCC1 |
| InChI | InChI=1S/C24H41N5O2/c1-25-24(26-18-20-10-14-28(15-11-20)16-17-30-2)27-19-23(29-12-4-5-13-29)21-6-8-22(31-3)9-7-21/h6-9,20,23H,4-5,10-19H2,1-3H3,(H2,25,26,27) |
| InChIKey | YANOYZABSKBCHY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|