C25H44IN5O2 — CID 111789507
1-ethyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-2-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide (PubChem CID 111789507) has the molecular formula C25H44IN5O2 and a molecular weight of 573.56 g/mol. Its IUPAC name is 1-ethyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-2-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-2-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111789507 |
| Molecular Formula | C25H44IN5O2 |
| Molecular Weight | 573.56 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | 1-ethyl-3-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-2-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1cccc(OC)c1)N1CCCC1)NCC1CCN(CCOC)CC1.I |
| InChI | InChI=1S/C25H43N5O2.HI/c1-4-26-25(27-19-21-10-14-29(15-11-21)16-17-31-2)28-20-24(30-12-5-6-13-30)22-8-7-9-23(18-22)32-3;/h7-9,18,21,24H,4-6,10-17,19-20H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | UEGVKQHRHNFGGE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|