C28H58O2Si2 — CID 11179171
[(1R,2S,3S,4R)-1-[(2R)-butan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhept-5-ynoxy]-tri(propan-2-yl)silane (PubChem CID 11179171) has the molecular formula C28H58O2Si2 and a molecular weight of 482.94 g/mol. Its IUPAC name is [(1R,2S,3S,4R)-1-[(2R)-butan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhept-5-ynoxy]-tri(propan-2-yl)silane.
| Compound Name | [(1R,2S,3S,4R)-1-[(2R)-butan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhept-5-ynoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11179171 |
| Molecular Formula | C28H58O2Si2 |
| Molecular Weight | 482.94 g/mol |
| Exact Mass | 482.40 |
| IUPAC Name | [(1R,2S,3S,4R)-1-[(2R)-butan-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhept-5-ynoxy]-tri(propan-2-yl)silane |
| SMILES | CC#C[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)CC |
| InChI | InChI=1S/C28H58O2Si2/c1-17-19-24(10)27(29-31(15,16)28(12,13)14)25(11)26(23(9)18-2)30-32(20(3)4,21(5)6)22(7)8/h20-27H,18H2,1-16H3/t23-,24-,25+,26-,27+/m1/s1 |
| InChIKey | XGQXNXLBEAHMSM-SEFGFODJSA-N |
| XLogP | 9.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.94 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|