About 4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]-N-phenylpiperazine-1-carboxamide
4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]-N-phenylpiperazine-1-carboxamide (PubChem CID 11179251) has the molecular formula C25H26N8O3
and a molecular weight of 486.54 g/mol. Its IUPAC name is 4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]-N-phenylpiperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]-N-phenylpiperazine-1-carboxamide |
| PubChem CID | 11179251 |
| Molecular Formula | C25H26N8O3 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]-N-phenylpiperazine-1-carboxamide |
| SMILES | COc1ccc(-c2cnc3nc(N)nc(N4CCN(C(=O)Nc5ccccc5)CC4)c3n2)cc1OC |
| InChI | InChI=1S/C25H26N8O3/c1-35-19-9-8-16(14-20(19)36-2)18-15-27-22-21(29-18)23(31-24(26)30-22)32-10-12-33(13-11-32)25(34)28-17-6-4-3-5-7-17/h3-9,14-15H,10-13H2,1-2H3,(H,28,34)(H2,26,27,30,31) |
| InChIKey | VZJXWOKRAVRCSH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]-N-phenylpiperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]-N-phenylpiperazine-1-carboxamide?
The IUPAC name of 4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]-N-phenylpiperazine-1-carboxamide (CID 11179251) is 4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]-N-phenylpiperazine-1-carboxamide.
What is the SMILES notation for 4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]-N-phenylpiperazine-1-carboxamide?
The canonical SMILES for 4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]-N-phenylpiperazine-1-carboxamide is COc1ccc(-c2cnc3nc(N)nc(N4CCN(C(=O)Nc5ccccc5)CC4)c3n2)cc1OC.
What is the InChIKey of 4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]-N-phenylpiperazine-1-carboxamide?
The InChIKey is VZJXWOKRAVRCSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N8O3/c1-35-19-9-8-16(14-20(19)36-2)18-15-27-22-21(29-18)23(31-24(26)30-22)32-10-12-33(13-11-32)25(34)28-17-6-4-3-5-7-17/h3-9,14-15H,10-13H2,1-2H3,(H,28,34)(H2,26,27,30,31).
What are the key properties of 4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]-N-phenylpiperazine-1-carboxamide?
4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]-N-phenylpiperazine-1-carboxamide has a molecular weight of 486.54 g/mol, XLogP of 3.04, 5 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-amino-6-(3,4-dimethoxyphenyl)pteridin-4-yl]-N-phenylpiperazine-1-carboxamide is sourced from PubChem (CID 11179251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).