C27H42N5O+ — CID 11179289
N-methoxy-9-methyl-7-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]purin-9-ium-6-amine (PubChem CID 11179289) has the molecular formula C27H42N5O+ and a molecular weight of 452.67 g/mol. Its IUPAC name is N-methoxy-9-methyl-7-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]purin-9-ium-6-amine.
| Compound Name | N-methoxy-9-methyl-7-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]purin-9-ium-6-amine |
|---|---|
| PubChem CID | 11179289 |
| Molecular Formula | C27H42N5O+ |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.34 |
| IUPAC Name | N-methoxy-9-methyl-7-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]purin-9-ium-6-amine |
| SMILES | CONc1ncnc2c1n(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)c[n+]2C |
| InChI | InChI=1S/C27H42N5O/c1-21(2)11-8-12-22(3)13-9-14-23(4)15-10-16-24(5)17-18-32-20-31(6)27-25(32)26(30-33-7)28-19-29-27/h11,13,15,17,19-20H,8-10,12,14,16,18H2,1-7H3,(H,28,29,30)/q+1/b22-13+,23-15+,24-17+ |
| InChIKey | BPVXQPOOGQHNQS-IYRYOAFKSA-N |
| XLogP | 6.37 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|