About 2-benzyl-1-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene)-3-phenylpropan-2-ol iodide
2-benzyl-1-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene)-3-phenylpropan-2-ol iodide (PubChem CID 11179318) has the molecular formula C25H32INO
and a molecular weight of 489.44 g/mol. Its IUPAC name is 2-benzyl-1-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene)-3-phenylpropan-2-ol iodide.
Molecular Properties
| Compound Name | 2-benzyl-1-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene)-3-phenylpropan-2-ol iodide |
| PubChem CID | 11179318 |
| Molecular Formula | C25H32INO |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 2-benzyl-1-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene)-3-phenylpropan-2-ol iodide |
| SMILES | C[N+]1(C)C2CCC1CC(=CC(O)(Cc1ccccc1)Cc1ccccc1)C2.[I-] |
| InChI | InChI=1S/C25H32NO.HI/c1-26(2)23-13-14-24(26)16-22(15-23)19-25(27,17-20-9-5-3-6-10-20)18-21-11-7-4-8-12-21;/h3-12,19,23-24,27H,13-18H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | PQZAQCOGMGANAE-UHFFFAOYSA-M |
| XLogP | 1.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-1-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene)-3-phenylpropan-2-ol iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene)-3-phenylpropan-2-ol iodide?
The IUPAC name of 2-benzyl-1-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene)-3-phenylpropan-2-ol iodide (CID 11179318) is 2-benzyl-1-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene)-3-phenylpropan-2-ol iodide.
What is the SMILES notation for 2-benzyl-1-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene)-3-phenylpropan-2-ol iodide?
The canonical SMILES for 2-benzyl-1-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene)-3-phenylpropan-2-ol iodide is C[N+]1(C)C2CCC1CC(=CC(O)(Cc1ccccc1)Cc1ccccc1)C2.[I-].
What is the InChIKey of 2-benzyl-1-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene)-3-phenylpropan-2-ol iodide?
The InChIKey is PQZAQCOGMGANAE-UHFFFAOYSA-M. The full InChI is InChI=1S/C25H32NO.HI/c1-26(2)23-13-14-24(26)16-22(15-23)19-25(27,17-20-9-5-3-6-10-20)18-21-11-7-4-8-12-21;/h3-12,19,23-24,27H,13-18H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 2-benzyl-1-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene)-3-phenylpropan-2-ol iodide?
2-benzyl-1-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene)-3-phenylpropan-2-ol iodide has a molecular weight of 489.44 g/mol, XLogP of 1.53, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene)-3-phenylpropan-2-ol iodide is sourced from PubChem (CID 11179318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).