C27H28ClN5O2 — CID 11179336
N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-5-[(2S)-1-[methyl(prop-2-enyl)amino]propan-2-yl]oxyquinazolin-4-amine (PubChem CID 11179336) has the molecular formula C27H28ClN5O2 and a molecular weight of 490.01 g/mol. Its IUPAC name is N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-5-[(2S)-1-[methyl(prop-2-enyl)amino]propan-2-yl]oxyquinazolin-4-amine.
| Compound Name | N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-5-[(2S)-1-[methyl(prop-2-enyl)amino]propan-2-yl]oxyquinazolin-4-amine |
|---|---|
| PubChem CID | 11179336 |
| Molecular Formula | C27H28ClN5O2 |
| Molecular Weight | 490.01 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-5-[(2S)-1-[methyl(prop-2-enyl)amino]propan-2-yl]oxyquinazolin-4-amine |
| SMILES | C=CCN(C)C[C@H](C)Oc1cccc2ncnc(Nc3ccc(OCc4ccccn4)c(Cl)c3)c12 |
| InChI | InChI=1S/C27H28ClN5O2/c1-4-14-33(3)16-19(2)35-25-10-7-9-23-26(25)27(31-18-30-23)32-20-11-12-24(22(28)15-20)34-17-21-8-5-6-13-29-21/h4-13,15,18-19H,1,14,16-17H2,2-3H3,(H,30,31,32)/t19-/m0/s1 |
| InChIKey | WJWHKADEASWSEO-IBGZPJMESA-N |
| XLogP | 5.89 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.01 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|