C21H17F6O3PS — CID 11179430
trifluoromethanesulfonate;triphenyl(2,2,2-trifluoroethyl)phosphanium (PubChem CID 11179430) has the molecular formula C21H17F6O3PS and a molecular weight of 494.39 g/mol. Its IUPAC name is trifluoromethanesulfonate;triphenyl(2,2,2-trifluoroethyl)phosphanium.
| Compound Name | trifluoromethanesulfonate;triphenyl(2,2,2-trifluoroethyl)phosphanium |
|---|---|
| PubChem CID | 11179430 |
| Molecular Formula | C21H17F6O3PS |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | trifluoromethanesulfonate;triphenyl(2,2,2-trifluoroethyl)phosphanium |
| SMILES | FC(F)(F)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C20H17F3P.CHF3O3S/c21-20(22,23)16-24(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;2-1(3,4)8(5,6)7/h1-15H,16H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | BNQHMYACORLPMI-UHFFFAOYSA-M |
| XLogP | 4.59 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|