C19H25N3O3 — CID 111794617
1-ethyl-3-[(2-hydroxy-5-methoxyphenyl)methyl]-2-[(3-methoxyphenyl)methyl]guanidine (PubChem CID 111794617) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-ethyl-3-[(2-hydroxy-5-methoxyphenyl)methyl]-2-[(3-methoxyphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[(2-hydroxy-5-methoxyphenyl)methyl]-2-[(3-methoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111794617 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-ethyl-3-[(2-hydroxy-5-methoxyphenyl)methyl]-2-[(3-methoxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1)NCc1cc(OC)ccc1O |
| InChI | InChI=1S/C19H25N3O3/c1-4-20-19(21-12-14-6-5-7-16(10-14)24-2)22-13-15-11-17(25-3)8-9-18(15)23/h5-11,23H,4,12-13H2,1-3H3,(H2,20,21,22) |
| InChIKey | CHFAARLNSMDRSG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|