C15H20IN3O2S — CID 111794818
1-[(2-hydroxy-5-methoxyphenyl)methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111794818) has the molecular formula C15H20IN3O2S and a molecular weight of 433.32 g/mol. Its IUPAC name is 1-[(2-hydroxy-5-methoxyphenyl)methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(2-hydroxy-5-methoxyphenyl)methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111794818 |
| Molecular Formula | C15H20IN3O2S |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 1-[(2-hydroxy-5-methoxyphenyl)methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccs1)NCc1cc(OC)ccc1O.I |
| InChI | InChI=1S/C15H19N3O2S.HI/c1-16-15(18-10-13-4-3-7-21-13)17-9-11-8-12(20-2)5-6-14(11)19;/h3-8,19H,9-10H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | BQBUXLQJXLZWFI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|