C31H35NO3Si — CID 11179509
(4S)-3-[(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 11179509) has the molecular formula C31H35NO3Si and a molecular weight of 497.71 g/mol. Its IUPAC name is (4S)-3-[(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11179509 |
| Molecular Formula | C31H35NO3Si |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | (4S)-3-[(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@@H]1N(C=C=C([C@H](O)c2ccccc2)[Si](C)(C)C)C(=O)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H35NO3Si/c1-23(2)29-31(25-17-11-7-12-18-25,26-19-13-8-14-20-26)35-30(34)32(29)22-21-27(36(3,4)5)28(33)24-15-9-6-10-16-24/h6-20,22-23,28-29,33H,1-5H3/t21?,28-,29+/m1/s1 |
| InChIKey | KUDPATDPOSSJLR-YOZFVKLBSA-N |
| XLogP | 7.06 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|