C20H30F2N6 — CID 111795259
1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine (PubChem CID 111795259) has the molecular formula C20H30F2N6 and a molecular weight of 392.50 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine.
| Compound Name | 1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111795259 |
| Molecular Formula | C20H30F2N6 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCC(c1c(F)cccc1F)N(C)C |
| InChI | InChI=1S/C20H30F2N6/c1-14-12-15(2)28(26-14)11-7-10-24-20(23-3)25-13-18(27(4)5)19-16(21)8-6-9-17(19)22/h6,8-9,12,18H,7,10-11,13H2,1-5H3,(H2,23,24,25) |
| InChIKey | CUTHEHIGGSZAFP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|