C31H28N6O — CID 11179557
1,3-bis[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]urea (PubChem CID 11179557) has the molecular formula C31H28N6O and a molecular weight of 500.61 g/mol. Its IUPAC name is 1,3-bis[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]urea.
| Compound Name | 1,3-bis[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 11179557 |
| Molecular Formula | C31H28N6O |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 1,3-bis[4-(5,6-dimethyl-1H-benzimidazol-2-yl)phenyl]urea |
| SMILES | Cc1cc2nc(-c3ccc(NC(=O)Nc4ccc(-c5nc6cc(C)c(C)cc6[nH]5)cc4)cc3)[nH]c2cc1C |
| InChI | InChI=1S/C31H28N6O/c1-17-13-25-26(14-18(17)2)35-29(34-25)21-5-9-23(10-6-21)32-31(38)33-24-11-7-22(8-12-24)30-36-27-15-19(3)20(4)16-28(27)37-30/h5-16H,1-4H3,(H,34,35)(H,36,37)(H2,32,33,38) |
| InChIKey | HCGJPCCNPPBVAZ-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |