C24H39NO10 — CID 11179577
tert-butyl (4R)-2,2-dimethyl-4-[2-[(2S,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]ethyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 11179577) has the molecular formula C24H39NO10 and a molecular weight of 501.57 g/mol. Its IUPAC name is tert-butyl (4R)-2,2-dimethyl-4-[2-[(2S,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]ethyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2-dimethyl-4-[2-[(2S,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]ethyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11179577 |
| Molecular Formula | C24H39NO10 |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | tert-butyl (4R)-2,2-dimethyl-4-[2-[(2S,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]ethyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@H](C)O[C@@H](CC[C@@H]2COC(C)(C)N2C(=O)OC(C)(C)C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H39NO10/c1-13-19(32-14(2)26)21(34-16(4)28)20(33-15(3)27)18(31-13)11-10-17-12-30-24(8,9)25(17)22(29)35-23(5,6)7/h13,17-21H,10-12H2,1-9H3/t13-,17+,18-,19+,20+,21+/m0/s1 |
| InChIKey | SXKQBBSTXQXJKM-DQRJTOMGSA-N |
| XLogP | 2.72 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|