C23H36N4O3 — CID 111796060
ethyl 4-[[N'-methyl-N-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111796060) has the molecular formula C23H36N4O3 and a molecular weight of 416.57 g/mol. Its IUPAC name is ethyl 4-[[N'-methyl-N-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-methyl-N-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111796060 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | ethyl 4-[[N'-methyl-N-[3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCCCOC2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C23H36N4O3/c1-3-29-23(28)27-15-12-19(13-16-27)26-22(24-2)25-14-7-17-30-21-11-6-9-18-8-4-5-10-20(18)21/h4-5,8,10,19,21H,3,6-7,9,11-17H2,1-2H3,(H2,24,25,26) |
| InChIKey | FSEXDQQGVKVZPI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|