C23H39BrO5Si — CID 11179615
(4R,6R)-6-[(1R,2E,4E,6R,8E)-9-bromo-1-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylnona-2,4,8-trienyl]-4-methoxyoxan-2-one (PubChem CID 11179615) has the molecular formula C23H39BrO5Si and a molecular weight of 503.55 g/mol. Its IUPAC name is (4R,6R)-6-[(1R,2E,4E,6R,8E)-9-bromo-1-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylnona-2,4,8-trienyl]-4-methoxyoxan-2-one.
| Compound Name | (4R,6R)-6-[(1R,2E,4E,6R,8E)-9-bromo-1-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylnona-2,4,8-trienyl]-4-methoxyoxan-2-one |
|---|---|
| PubChem CID | 11179615 |
| Molecular Formula | C23H39BrO5Si |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | (4R,6R)-6-[(1R,2E,4E,6R,8E)-9-bromo-1-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylnona-2,4,8-trienyl]-4-methoxyoxan-2-one |
| SMILES | CO[C@H]1CC(=O)O[C@@H]([C@@H](/C=C(C)/C=C/[C@@H](C/C=C/Br)OC)O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C23H39BrO5Si/c1-17(11-12-18(26-5)10-9-13-24)14-21(29-30(7,8)23(2,3)4)20-15-19(27-6)16-22(25)28-20/h9,11-14,18-21H,10,15-16H2,1-8H3/b12-11+,13-9+,17-14+/t18-,19-,20-,21-/m1/s1 |
| InChIKey | VWUDMFMZAPSSGD-WLOHCCKZSA-N |
| XLogP | 5.91 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|