C18H36N4O — CID 111796988
1-(3-cyclopropylpropyl)-3-ethyl-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine (PubChem CID 111796988) has the molecular formula C18H36N4O and a molecular weight of 324.51 g/mol. Its IUPAC name is 1-(3-cyclopropylpropyl)-3-ethyl-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine.
| Compound Name | 1-(3-cyclopropylpropyl)-3-ethyl-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111796988 |
| Molecular Formula | C18H36N4O |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.29 |
| IUPAC Name | 1-(3-cyclopropylpropyl)-3-ethyl-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1CN(CC(C)C)CCO1)NCCCC1CC1 |
| InChI | InChI=1S/C18H36N4O/c1-4-19-18(20-9-5-6-16-7-8-16)21-12-17-14-22(10-11-23-17)13-15(2)3/h15-17H,4-14H2,1-3H3,(H2,19,20,21) |
| InChIKey | JENKPHXQSKHAFY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|