C20H32IN7O — CID 111797017
2-methyl-1-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111797017) has the molecular formula C20H32IN7O and a molecular weight of 513.43 g/mol. Its IUPAC name is 2-methyl-1-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111797017 |
| Molecular Formula | C20H32IN7O |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 2-methyl-1-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(-c2ncn[nH]2)c1)NCC1CN(CC(C)C)CCO1.I |
| InChI | InChI=1S/C20H31N7O.HI/c1-15(2)12-27-7-8-28-18(13-27)11-23-20(21-3)22-10-16-5-4-6-17(9-16)19-24-14-25-26-19;/h4-6,9,14-15,18H,7-8,10-13H2,1-3H3,(H2,21,22,23)(H,24,25,26);1H |
| InChIKey | JNWWVESTXWYGGU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|