C30H41NO4Si — CID 11179706
tert-butyl (4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxo-4-prop-2-enylpiperidine-1-carboxylate (PubChem CID 11179706) has the molecular formula C30H41NO4Si and a molecular weight of 507.75 g/mol. Its IUPAC name is tert-butyl (4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxo-4-prop-2-enylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxo-4-prop-2-enylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11179706 |
| Molecular Formula | C30H41NO4Si |
| Molecular Weight | 507.75 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | tert-butyl (4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxo-4-prop-2-enylpiperidine-1-carboxylate |
| SMILES | C=CC[C@H]1CC(=O)N(C(=O)OC(C)(C)C)C[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H41NO4Si/c1-8-15-23-20-27(32)31(28(33)35-29(2,3)4)21-24(23)22-34-36(30(5,6)7,25-16-11-9-12-17-25)26-18-13-10-14-19-26/h8-14,16-19,23-24H,1,15,20-22H2,2-7H3/t23-,24+/m0/s1 |
| InChIKey | YYWMLXILOPBZPJ-BJKOFHAPSA-N |
| XLogP | 5.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.75 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|