C24H32IN5O3 — CID 111797180
1-[(1-benzylimidazol-2-yl)methyl]-3-ethyl-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111797180) has the molecular formula C24H32IN5O3 and a molecular weight of 565.46 g/mol. Its IUPAC name is 1-[(1-benzylimidazol-2-yl)methyl]-3-ethyl-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(1-benzylimidazol-2-yl)methyl]-3-ethyl-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111797180 |
| Molecular Formula | C24H32IN5O3 |
| Molecular Weight | 565.46 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | 1-[(1-benzylimidazol-2-yl)methyl]-3-ethyl-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)c(OC)c1)NCc1nccn1Cc1ccccc1.I |
| InChI | InChI=1S/C24H31N5O3.HI/c1-5-25-24(27-15-19-13-20(30-2)23(32-4)21(14-19)31-3)28-16-22-26-11-12-29(22)17-18-9-7-6-8-10-18;/h6-14H,5,15-17H2,1-4H3,(H2,25,27,28);1H |
| InChIKey | NJTHKMOGZLEKCH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|