C26H36N4O8 — CID 11180133
1,4-bis[2-[bis(2-hydroxyethyl)amino]ethylamino]-5,8-dihydroxyanthracene-9,10-dione (PubChem CID 11180133) has the molecular formula C26H36N4O8 and a molecular weight of 532.59 g/mol. Its IUPAC name is 1,4-bis[2-[bis(2-hydroxyethyl)amino]ethylamino]-5,8-dihydroxyanthracene-9,10-dione.
| Compound Name | 1,4-bis[2-[bis(2-hydroxyethyl)amino]ethylamino]-5,8-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 11180133 |
| Molecular Formula | C26H36N4O8 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 1,4-bis[2-[bis(2-hydroxyethyl)amino]ethylamino]-5,8-dihydroxyanthracene-9,10-dione |
| SMILES | O=C1c2c(O)ccc(O)c2C(=O)c2c(NCCN(CCO)CCO)ccc(NCCN(CCO)CCO)c21 |
| InChI | InChI=1S/C26H36N4O8/c31-13-9-29(10-14-32)7-5-27-17-1-2-18(28-6-8-30(11-15-33)12-16-34)22-21(17)25(37)23-19(35)3-4-20(36)24(23)26(22)38/h1-4,27-28,31-36H,5-16H2 |
| InChIKey | JNAUXWHKZZFQDY-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 186.06 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|