About 2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-propan-2-ylguanidine;hydroiodide
2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-propan-2-ylguanidine;hydroiodide (PubChem CID 111803167) has the molecular formula C9H20F3IN4
and a molecular weight of 368.19 g/mol. Its IUPAC name is 2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-propan-2-ylguanidine;hydroiodide.
Molecular Properties
| Compound Name | 2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-propan-2-ylguanidine;hydroiodide |
| PubChem CID | 111803167 |
| Molecular Formula | C9H20F3IN4 |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-propan-2-ylguanidine;hydroiodide |
| SMILES | CC(C)N/C(N)=N/CCN(C)CC(F)(F)F.I |
| InChI | InChI=1S/C9H19F3N4.HI/c1-7(2)15-8(13)14-4-5-16(3)6-9(10,11)12;/h7H,4-6H2,1-3H3,(H3,13,14,15);1H |
| InChIKey | XNCFGHZIBZSRRR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-propan-2-ylguanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-propan-2-ylguanidine;hydroiodide?
The IUPAC name of 2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-propan-2-ylguanidine;hydroiodide (CID 111803167) is 2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-propan-2-ylguanidine;hydroiodide.
What is the SMILES notation for 2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-propan-2-ylguanidine;hydroiodide?
The canonical SMILES for 2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-propan-2-ylguanidine;hydroiodide is CC(C)N/C(N)=N/CCN(C)CC(F)(F)F.I.
What is the InChIKey of 2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-propan-2-ylguanidine;hydroiodide?
The InChIKey is XNCFGHZIBZSRRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F3N4.HI/c1-7(2)15-8(13)14-4-5-16(3)6-9(10,11)12;/h7H,4-6H2,1-3H3,(H3,13,14,15);1H.
What are the key properties of 2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-propan-2-ylguanidine;hydroiodide?
2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-propan-2-ylguanidine;hydroiodide has a molecular weight of 368.19 g/mol, XLogP of 1.41, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-propan-2-ylguanidine;hydroiodide is sourced from PubChem (CID 111803167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).