C28H56O6Si2 — CID 11180318
2-[(2R,4S,6R,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-2-[tri(propan-2-yl)silyloxymethyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetaldehyde (PubChem CID 11180318) has the molecular formula C28H56O6Si2 and a molecular weight of 544.92 g/mol. Its IUPAC name is 2-[(2R,4S,6R,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-2-[tri(propan-2-yl)silyloxymethyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetaldehyde.
| Compound Name | 2-[(2R,4S,6R,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-2-[tri(propan-2-yl)silyloxymethyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetaldehyde |
|---|---|
| PubChem CID | 11180318 |
| Molecular Formula | C28H56O6Si2 |
| Molecular Weight | 544.92 g/mol |
| Exact Mass | 544.36 |
| IUPAC Name | 2-[(2R,4S,6R,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-2-[tri(propan-2-yl)silyloxymethyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetaldehyde |
| SMILES | CO[C@H]1C[C@@H](CC=O)O[C@@]2(C1)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)O2 |
| InChI | InChI=1S/C28H56O6Si2/c1-20(2)36(21(3)4,22(5)6)31-19-26-16-25(34-35(11,12)27(7,8)9)18-28(33-26)17-24(30-10)15-23(32-28)13-14-29/h14,20-26H,13,15-19H2,1-12H3/t23-,24+,25+,26-,28-/m1/s1 |
| InChIKey | WSYBRHNSSYGDTP-BZTMQRDQSA-N |
| XLogP | 7.23 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.92 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|