C15H29F3IN5O2 — CID 111803201
tert-butyl 4-[N'-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111803201) has the molecular formula C15H29F3IN5O2 and a molecular weight of 495.33 g/mol. Its IUPAC name is tert-butyl 4-[N'-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[N'-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111803201 |
| Molecular Formula | C15H29F3IN5O2 |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | tert-butyl 4-[N'-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CN(CC/N=C(\N)N1CCN(C(=O)OC(C)(C)C)CC1)CC(F)(F)F.I |
| InChI | InChI=1S/C15H28F3N5O2.HI/c1-14(2,3)25-13(24)23-9-7-22(8-10-23)12(19)20-5-6-21(4)11-15(16,17)18;/h5-11H2,1-4H3,(H2,19,20);1H |
| InChIKey | JYMLDYJPLSIPQO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 74.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|