C13H27F3IN5O — CID 111803221
2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide (PubChem CID 111803221) has the molecular formula C13H27F3IN5O and a molecular weight of 453.29 g/mol. Its IUPAC name is 2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111803221 |
| Molecular Formula | C13H27F3IN5O |
| Molecular Weight | 453.29 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCN(C)CC(F)(F)F)NCCN1CCOCC1.I |
| InChI | InChI=1S/C13H26F3N5O.HI/c1-17-12(18-3-5-20(2)11-13(14,15)16)19-4-6-21-7-9-22-10-8-21;/h3-11H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | ZQYFPFXRAPGHBW-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|