About 2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine
2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine (PubChem CID 111803222) has the molecular formula C13H26F3N5O
and a molecular weight of 325.38 g/mol. Its IUPAC name is 2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine.
Molecular Properties
| Compound Name | 2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine |
| PubChem CID | 111803222 |
| Molecular Formula | C13H26F3N5O |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | 2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine |
| SMILES | C/N=C(\NCCN(C)CC(F)(F)F)NCCN1CCOCC1 |
| InChI | InChI=1S/C13H26F3N5O/c1-17-12(18-3-5-20(2)11-13(14,15)16)19-4-6-21-7-9-22-10-8-21/h3-11H2,1-2H3,(H2,17,18,19) |
| InChIKey | ZQZSIWLESJYERE-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine?
The IUPAC name of 2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine (CID 111803222) is 2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine.
What is the SMILES notation for 2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine?
The canonical SMILES for 2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine is C/N=C(\NCCN(C)CC(F)(F)F)NCCN1CCOCC1.
What is the InChIKey of 2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine?
The InChIKey is ZQZSIWLESJYERE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26F3N5O/c1-17-12(18-3-5-20(2)11-13(14,15)16)19-4-6-21-7-9-22-10-8-21/h3-11H2,1-2H3,(H2,17,18,19).
What are the key properties of 2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine?
2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine has a molecular weight of 325.38 g/mol, XLogP of -0.02, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-(2-morpholin-4-ylethyl)guanidine is sourced from PubChem (CID 111803222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).