C31H42N4O5 — CID 11180385
(6R,9R,12S,16E)-6-[(4-hydroxyphenyl)methyl]-12-(2-methylpropyl)-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione (PubChem CID 11180385) has the molecular formula C31H42N4O5 and a molecular weight of 550.70 g/mol. Its IUPAC name is (6R,9R,12S,16E)-6-[(4-hydroxyphenyl)methyl]-12-(2-methylpropyl)-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione.
| Compound Name | (6R,9R,12S,16E)-6-[(4-hydroxyphenyl)methyl]-12-(2-methylpropyl)-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione |
|---|---|
| PubChem CID | 11180385 |
| Molecular Formula | C31H42N4O5 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | (6R,9R,12S,16E)-6-[(4-hydroxyphenyl)methyl]-12-(2-methylpropyl)-9-propan-2-yl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),16,18,20-tetraene-7,10,13-trione |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H](C(C)C)NC(=O)[C@@H](Cc2ccc(O)cc2)NCCOc2ccccc2/C=C/CNC1=O |
| InChI | InChI=1S/C31H42N4O5/c1-20(2)18-26-29(37)33-15-7-9-23-8-5-6-10-27(23)40-17-16-32-25(19-22-11-13-24(36)14-12-22)30(38)35-28(21(3)4)31(39)34-26/h5-14,20-21,25-26,28,32,36H,15-19H2,1-4H3,(H,33,37)(H,34,39)(H,35,38)/b9-7+/t25-,26+,28-/m1/s1 |
| InChIKey | NBIAEYWURXAHQI-OFYMXCLBSA-N |
| XLogP | 2.79 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |