C29H24ClFN4O3S — CID 11180531
(4-fluorophenyl) 6-chloro-1-[4-[2-(1,3-thiazol-2-ylamino)ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 11180531) has the molecular formula C29H24ClFN4O3S and a molecular weight of 563.05 g/mol. Its IUPAC name is (4-fluorophenyl) 6-chloro-1-[4-[2-(1,3-thiazol-2-ylamino)ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-fluorophenyl) 6-chloro-1-[4-[2-(1,3-thiazol-2-ylamino)ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 11180531 |
| Molecular Formula | C29H24ClFN4O3S |
| Molecular Weight | 563.05 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | (4-fluorophenyl) 6-chloro-1-[4-[2-(1,3-thiazol-2-ylamino)ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | O=C(Oc1ccc(F)cc1)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1ccc(OCCNc2nccs2)cc1 |
| InChI | InChI=1S/C29H24ClFN4O3S/c30-19-3-10-25-24(17-19)23-11-14-35(29(36)38-22-8-4-20(31)5-9-22)27(26(23)34-25)18-1-6-21(7-2-18)37-15-12-32-28-33-13-16-39-28/h1-10,13,16-17,27,34H,11-12,14-15H2,(H,32,33) |
| InChIKey | JFBBWBSGQCPSTK-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.05 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|