C19H23N3O2 — CID 111805322
N'-[[2-(2-methylphenoxy)phenyl]methyl]morpholine-4-carboximidamide (PubChem CID 111805322) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is N'-[[2-(2-methylphenoxy)phenyl]methyl]morpholine-4-carboximidamide.
| Compound Name | N'-[[2-(2-methylphenoxy)phenyl]methyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111805322 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N'-[[2-(2-methylphenoxy)phenyl]methyl]morpholine-4-carboximidamide |
| SMILES | Cc1ccccc1Oc1ccccc1C/N=C(\N)N1CCOCC1 |
| InChI | InChI=1S/C19H23N3O2/c1-15-6-2-4-8-17(15)24-18-9-5-3-7-16(18)14-21-19(20)22-10-12-23-13-11-22/h2-9H,10-14H2,1H3,(H2,20,21) |
| InChIKey | DNBOZOOBEMNVMG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|