C24H35N5O2 — CID 111805960
2-[(3,4-dimethoxyphenyl)methyl]-1-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]ethyl]guanidine (PubChem CID 111805960) has the molecular formula C24H35N5O2 and a molecular weight of 425.58 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]ethyl]guanidine.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111805960 |
| Molecular Formula | C24H35N5O2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]ethyl]guanidine |
| SMILES | COc1ccc(C/N=C(\N)NCCN2CCN(c3cccc(C)c3C)CC2)cc1OC |
| InChI | InChI=1S/C24H35N5O2/c1-18-6-5-7-21(19(18)2)29-14-12-28(13-15-29)11-10-26-24(25)27-17-20-8-9-22(30-3)23(16-20)31-4/h5-9,16H,10-15,17H2,1-4H3,(H3,25,26,27) |
| InChIKey | NZYIMUWNYQBRTG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|