C15H23IN4O2 — CID 111806011
2-(2-methylprop-2-enyl)-1-[4-(4-nitrophenyl)butyl]guanidine;hydroiodide (PubChem CID 111806011) has the molecular formula C15H23IN4O2 and a molecular weight of 418.28 g/mol. Its IUPAC name is 2-(2-methylprop-2-enyl)-1-[4-(4-nitrophenyl)butyl]guanidine;hydroiodide.
| Compound Name | 2-(2-methylprop-2-enyl)-1-[4-(4-nitrophenyl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111806011 |
| Molecular Formula | C15H23IN4O2 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 2-(2-methylprop-2-enyl)-1-[4-(4-nitrophenyl)butyl]guanidine;hydroiodide |
| SMILES | C=C(C)C/N=C(\N)NCCCCc1ccc([N+](=O)[O-])cc1.I |
| InChI | InChI=1S/C15H22N4O2.HI/c1-12(2)11-18-15(16)17-10-4-3-5-13-6-8-14(9-7-13)19(20)21;/h6-9H,1,3-5,10-11H2,2H3,(H3,16,17,18);1H |
| InChIKey | GPJXLJQRSQULOS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|